C17H26O3 — CID 114622577
3-phenoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol (PubChem CID 114622577) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-phenoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol.
| Compound Name | 3-phenoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 114622577 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-phenoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol |
| SMILES | CC1(C)CC(C(O)CCOc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C17H26O3/c1-16(2)12-14(17(3,4)20-16)15(18)10-11-19-13-8-6-5-7-9-13/h5-9,14-15,18H,10-12H2,1-4H3 |
| InChIKey | ZREIBICEAWUNDV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |