C18H28O3 — CID 114622770
2-ethoxy-2-phenyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanol (PubChem CID 114622770) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-ethoxy-2-phenyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanol.
| Compound Name | 2-ethoxy-2-phenyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 114622770 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-ethoxy-2-phenyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanol |
| SMILES | CCOC(c1ccccc1)C(O)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C18H28O3/c1-6-20-16(13-10-8-7-9-11-13)15(19)14-12-17(2,3)21-18(14,4)5/h7-11,14-16,19H,6,12H2,1-5H3 |
| InChIKey | AJAZFNYLIDOCSB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |