C16H15F3N4 — CID 10519719
5-cyclopentyl-3-[4-(trifluoromethyl)anilino]-1H-pyrazole-4-carbonitrile (PubChem CID 10519719) has the molecular formula C16H15F3N4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 5-cyclopentyl-3-[4-(trifluoromethyl)anilino]-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-cyclopentyl-3-[4-(trifluoromethyl)anilino]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 10519719 |
| Molecular Formula | C16H15F3N4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-cyclopentyl-3-[4-(trifluoromethyl)anilino]-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(Nc2ccc(C(F)(F)F)cc2)n[nH]c1C1CCCC1 |
| InChI | InChI=1S/C16H15F3N4/c17-16(18,19)11-5-7-12(8-6-11)21-15-13(9-20)14(22-23-15)10-3-1-2-4-10/h5-8,10H,1-4H2,(H2,21,22,23) |
| InChIKey | NXRYQCUIWXFJHK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |