C16H12F4OS — CID 10520310
2-[difluoro-(4-methylphenyl)sulfanylmethyl]-2-(2,4-difluorophenyl)oxirane (PubChem CID 10520310) has the molecular formula C16H12F4OS and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-[difluoro-(4-methylphenyl)sulfanylmethyl]-2-(2,4-difluorophenyl)oxirane.
| Compound Name | 2-[difluoro-(4-methylphenyl)sulfanylmethyl]-2-(2,4-difluorophenyl)oxirane |
|---|---|
| PubChem CID | 10520310 |
| Molecular Formula | C16H12F4OS |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[difluoro-(4-methylphenyl)sulfanylmethyl]-2-(2,4-difluorophenyl)oxirane |
| SMILES | Cc1ccc(SC(F)(F)C2(c3ccc(F)cc3F)CO2)cc1 |
| InChI | InChI=1S/C16H12F4OS/c1-10-2-5-12(6-3-10)22-16(19,20)15(9-21-15)13-7-4-11(17)8-14(13)18/h2-8H,9H2,1H3 |
| InChIKey | RWEIAJAOXXARCV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|