C12H20N4O — CID 105203720
[4-(oxolan-2-yl)-1-pyrimidin-2-ylbutyl]hydrazine (PubChem CID 105203720) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is [4-(oxolan-2-yl)-1-pyrimidin-2-ylbutyl]hydrazine.
| Compound Name | [4-(oxolan-2-yl)-1-pyrimidin-2-ylbutyl]hydrazine |
|---|---|
| PubChem CID | 105203720 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | [4-(oxolan-2-yl)-1-pyrimidin-2-ylbutyl]hydrazine |
| SMILES | NNC(CCCC1CCCO1)c1ncccn1 |
| InChI | InChI=1S/C12H20N4O/c13-16-11(12-14-7-3-8-15-12)6-1-4-10-5-2-9-17-10/h3,7-8,10-11,16H,1-2,4-6,9,13H2 |
| InChIKey | PKEHNSHNRANWJW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|