C16H22N4O — CID 105314120
[4-(oxolan-2-yl)-1-quinoxalin-5-ylbutyl]hydrazine (PubChem CID 105314120) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is [4-(oxolan-2-yl)-1-quinoxalin-5-ylbutyl]hydrazine.
| Compound Name | [4-(oxolan-2-yl)-1-quinoxalin-5-ylbutyl]hydrazine |
|---|---|
| PubChem CID | 105314120 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [4-(oxolan-2-yl)-1-quinoxalin-5-ylbutyl]hydrazine |
| SMILES | NNC(CCCC1CCCO1)c1cccc2nccnc12 |
| InChI | InChI=1S/C16H22N4O/c17-20-14(7-1-4-12-5-3-11-21-12)13-6-2-8-15-16(13)19-10-9-18-15/h2,6,8-10,12,14,20H,1,3-5,7,11,17H2 |
| InChIKey | FWAHXLKYTQXCJW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|