C12H14FN3S — CID 105204168
[1-(4-fluoro-3-methylphenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105204168) has the molecular formula C12H14FN3S and a molecular weight of 251.33 g/mol. Its IUPAC name is [1-(4-fluoro-3-methylphenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(4-fluoro-3-methylphenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105204168 |
| Molecular Formula | C12H14FN3S |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [1-(4-fluoro-3-methylphenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | Cc1cc(C(Cc2nccs2)NN)ccc1F |
| InChI | InChI=1S/C12H14FN3S/c1-8-6-9(2-3-10(8)13)11(16-14)7-12-15-4-5-17-12/h2-6,11,16H,7,14H2,1H3 |
| InChIKey | HJQYUZMQUZDDDK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|