C11H11ClFN3S — CID 105280199
[1-(5-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105280199) has the molecular formula C11H11ClFN3S and a molecular weight of 271.75 g/mol. Its IUPAC name is [1-(5-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(5-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105280199 |
| Molecular Formula | C11H11ClFN3S |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | [1-(5-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1nccs1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H11ClFN3S/c12-7-1-2-9(13)8(5-7)10(16-14)6-11-15-3-4-17-11/h1-5,10,16H,6,14H2 |
| InChIKey | AKFAFQGCVUUPML-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|