C12H14ClN3OS — CID 105324483
[1-(3-chlorophenoxy)-3-(1,3-thiazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105324483) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is [1-(3-chlorophenoxy)-3-(1,3-thiazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-chlorophenoxy)-3-(1,3-thiazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105324483 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | [1-(3-chlorophenoxy)-3-(1,3-thiazol-2-yl)propan-2-yl]hydrazine |
| SMILES | NNC(COc1cccc(Cl)c1)Cc1nccs1 |
| InChI | InChI=1S/C12H14ClN3OS/c13-9-2-1-3-11(6-9)17-8-10(16-14)7-12-15-4-5-18-12/h1-6,10,16H,7-8,14H2 |
| InChIKey | AYYFHQFCDBSXCA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|