C15H25ClN2O — CID 114211647
[1-(3-chlorophenoxy)-6,6-dimethylheptan-2-yl]hydrazine (PubChem CID 114211647) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is [1-(3-chlorophenoxy)-6,6-dimethylheptan-2-yl]hydrazine.
| Compound Name | [1-(3-chlorophenoxy)-6,6-dimethylheptan-2-yl]hydrazine |
|---|---|
| PubChem CID | 114211647 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [1-(3-chlorophenoxy)-6,6-dimethylheptan-2-yl]hydrazine |
| SMILES | CC(C)(C)CCCC(COc1cccc(Cl)c1)NN |
| InChI | InChI=1S/C15H25ClN2O/c1-15(2,3)9-5-7-13(18-17)11-19-14-8-4-6-12(16)10-14/h4,6,8,10,13,18H,5,7,9,11,17H2,1-3H3 |
| InChIKey | RFRPUUAKGSIFOT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|