C16H30N2OZn — CID 10520540
zinc;butane;cyclohexen-1-yl-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]azanide (PubChem CID 10520540) has the molecular formula C16H30N2OZn and a molecular weight of 331.82 g/mol. Its IUPAC name is zinc;butane;cyclohexen-1-yl-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]azanide.
| Compound Name | zinc;butane;cyclohexen-1-yl-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]azanide |
|---|---|
| PubChem CID | 10520540 |
| Molecular Formula | C16H30N2OZn |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | zinc;butane;cyclohexen-1-yl-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]azanide |
| SMILES | COC[C@@H]1CCCN1[N-]C1=CCCCC1.[CH2-]CCC.[Zn+2] |
| InChI | InChI=1S/C12H21N2O.C4H9.Zn/c1-15-10-12-8-5-9-14(12)13-11-6-3-2-4-7-11;1-3-4-2;/h6,12H,2-5,7-10H2,1H3;1,3-4H2,2H3;/q2*-1;+2/t12-;;/m0../s1 |
| InChIKey | XMZZTUQPULDSGD-LTCKWSDVSA-N |
| XLogP | 4.46 |
| TPSA | 26.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|