C24H47NOSn — CID 14250108
tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclohex-2-en-1-yl]stannane (PubChem CID 14250108) has the molecular formula C24H47NOSn and a molecular weight of 484.36 g/mol. Its IUPAC name is tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclohex-2-en-1-yl]stannane.
| Compound Name | tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclohex-2-en-1-yl]stannane |
|---|---|
| PubChem CID | 14250108 |
| Molecular Formula | C24H47NOSn |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclohex-2-en-1-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1C=C(N2CCCC2COC)CCC1 |
| InChI | InChI=1S/C12H20NO.3C4H9.Sn/c1-14-10-12-8-5-9-13(12)11-6-3-2-4-7-11;3*1-3-4-2;/h3,6,12H,2,4-5,7-10H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | SMFCARSKSAPAST-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |