C17H33NOSi — CID 134863476
tert-butyl-[[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]methoxy]-dimethylsilane (PubChem CID 134863476) has the molecular formula C17H33NOSi and a molecular weight of 295.54 g/mol. Its IUPAC name is tert-butyl-[[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134863476 |
| Molecular Formula | C17H33NOSi |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | tert-butyl-[[(2S)-1-(cyclohexen-1-yl)pyrrolidin-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCCN1C1=CCCCC1 |
| InChI | InChI=1S/C17H33NOSi/c1-17(2,3)20(4,5)19-14-16-12-9-13-18(16)15-10-7-6-8-11-15/h10,16H,6-9,11-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | ZHCNLLHUUJTLLG-INIZCTEOSA-N |
| XLogP | 4.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|