C24H49NOSn — CID 14250123
tributyl-[(E)-4-[2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]stannane (PubChem CID 14250123) has the molecular formula C24H49NOSn and a molecular weight of 486.37 g/mol. Its IUPAC name is tributyl-[(E)-4-[2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]stannane.
| Compound Name | tributyl-[(E)-4-[2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]stannane |
|---|---|
| PubChem CID | 14250123 |
| Molecular Formula | C24H49NOSn |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | tributyl-[(E)-4-[2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(C)/C=C(\CC)N1CCCC1COC |
| InChI | InChI=1S/C12H22NO.3C4H9.Sn/c1-4-7-11(5-2)13-9-6-8-12(13)10-14-3;3*1-3-4-2;/h4,7,12H,5-6,8-10H2,1-3H3;3*1,3-4H2,2H3;/b11-7+;;;; |
| InChIKey | FVPZQMHMFQFORK-UTUIWUMXSA-N |
| XLogP | 7.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |