C23H45NOSn — CID 14250116
tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclopent-2-en-1-yl]stannane (PubChem CID 14250116) has the molecular formula C23H45NOSn and a molecular weight of 470.33 g/mol. Its IUPAC name is tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclopent-2-en-1-yl]stannane.
| Compound Name | tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclopent-2-en-1-yl]stannane |
|---|---|
| PubChem CID | 14250116 |
| Molecular Formula | C23H45NOSn |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | tributyl-[3-[2-(methoxymethyl)pyrrolidin-1-yl]cyclopent-2-en-1-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1C=C(N2CCCC2COC)CC1 |
| InChI | InChI=1S/C11H18NO.3C4H9.Sn/c1-13-9-11-7-4-8-12(11)10-5-2-3-6-10;3*1-3-4-2;/h2,5,11H,3-4,6-9H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | HXLLJANNPBVQFH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |