C8H5Br2N3O2 — CID 10520762
5-amino-6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 10520762) has the molecular formula C8H5Br2N3O2 and a molecular weight of 334.96 g/mol. Its IUPAC name is 5-amino-6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 5-amino-6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10520762 |
| Molecular Formula | C8H5Br2N3O2 |
| Molecular Weight | 334.96 g/mol |
| Exact Mass | 332.87 |
| IUPAC Name | 5-amino-6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Nc1c(Br)c(Br)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C8H5Br2N3O2/c9-2-1-3-6(5(11)4(2)10)13-8(15)7(14)12-3/h1H,11H2,(H,12,14)(H,13,15) |
| InChIKey | JFVDZBLVGCRNIX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.96 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|