C12H16N2 — CID 105211357
1-(4-methylphenyl)pent-4-yn-2-ylhydrazine (PubChem CID 105211357) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(4-methylphenyl)pent-4-yn-2-ylhydrazine.
| Compound Name | 1-(4-methylphenyl)pent-4-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105211357 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(4-methylphenyl)pent-4-yn-2-ylhydrazine |
| SMILES | C#CCC(Cc1ccc(C)cc1)NN |
| InChI | InChI=1S/C12H16N2/c1-3-4-12(14-13)9-11-7-5-10(2)6-8-11/h1,5-8,12,14H,4,9,13H2,2H3 |
| InChIKey | HLUXCUPNNLEFKB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|