C20H38O4 — CID 10521277
9-[5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-2-one (PubChem CID 10521277) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 9-[5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-2-one.
| Compound Name | 9-[5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-2-one |
|---|---|
| PubChem CID | 10521277 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 9-[5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-2-one |
| SMILES | CC(=O)CCCCCCCC1OC(C)(C)OC1CCCCCCO |
| InChI | InChI=1S/C20H38O4/c1-17(22)13-9-5-4-6-10-14-18-19(24-20(2,3)23-18)15-11-7-8-12-16-21/h18-19,21H,4-16H2,1-3H3 |
| InChIKey | WJWSXUHLCGGRQD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|