C13H11Br2F3N2S — CID 105212857
[2-(4-bromothiophen-2-yl)-1-[4-bromo-2-(trifluoromethyl)phenyl]ethyl]hydrazine (PubChem CID 105212857) has the molecular formula C13H11Br2F3N2S and a molecular weight of 444.11 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-1-[4-bromo-2-(trifluoromethyl)phenyl]ethyl]hydrazine.
| Compound Name | [2-(4-bromothiophen-2-yl)-1-[4-bromo-2-(trifluoromethyl)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105212857 |
| Molecular Formula | C13H11Br2F3N2S |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-1-[4-bromo-2-(trifluoromethyl)phenyl]ethyl]hydrazine |
| SMILES | NNC(Cc1cc(Br)cs1)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H11Br2F3N2S/c14-7-1-2-10(11(4-7)13(16,17)18)12(20-19)5-9-3-8(15)6-21-9/h1-4,6,12,20H,5,19H2 |
| InChIKey | ZBWPJEBWIZDTNE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|