C13H13BrF3N3S — CID 105264927
2-[2-(4-bromothiophen-2-yl)-1-hydrazinylethyl]-4-(trifluoromethyl)aniline (PubChem CID 105264927) has the molecular formula C13H13BrF3N3S and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-[2-(4-bromothiophen-2-yl)-1-hydrazinylethyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-[2-(4-bromothiophen-2-yl)-1-hydrazinylethyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 105264927 |
| Molecular Formula | C13H13BrF3N3S |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2-[2-(4-bromothiophen-2-yl)-1-hydrazinylethyl]-4-(trifluoromethyl)aniline |
| SMILES | NNC(Cc1cc(Br)cs1)c1cc(C(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H13BrF3N3S/c14-8-4-9(21-6-8)5-12(20-19)10-3-7(13(15,16)17)1-2-11(10)18/h1-4,6,12,20H,5,18-19H2 |
| InChIKey | HFFWEWOEAZVXTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|