C20H13N3O3 — CID 10521308
14-hydroxy-8-(2-methylphenyl)-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaene-3,5-dione (PubChem CID 10521308) has the molecular formula C20H13N3O3 and a molecular weight of 343.34 g/mol. Its IUPAC name is 14-hydroxy-8-(2-methylphenyl)-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaene-3,5-dione.
| Compound Name | 14-hydroxy-8-(2-methylphenyl)-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaene-3,5-dione |
|---|---|
| PubChem CID | 10521308 |
| Molecular Formula | C20H13N3O3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 14-hydroxy-8-(2-methylphenyl)-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaene-3,5-dione |
| SMILES | Cc1ccccc1-c1nc2c(c3c1[nH]c1ccc(O)cc13)C(=O)NC2=O |
| InChI | InChI=1S/C20H13N3O3/c1-9-4-2-3-5-11(9)16-17-14(12-8-10(24)6-7-13(12)21-17)15-18(22-16)20(26)23-19(15)25/h2-8,21,24H,1H3,(H,23,25,26) |
| InChIKey | FKUHLMBHESFSSP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|