C21H32O2Si — CID 10521411
tert-butyl-dimethyl-[3-[(S)-phenyl(prop-2-enoxy)methyl]penta-1,4-dien-3-yloxy]silane (PubChem CID 10521411) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[(S)-phenyl(prop-2-enoxy)methyl]penta-1,4-dien-3-yloxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-[(S)-phenyl(prop-2-enoxy)methyl]penta-1,4-dien-3-yloxy]silane |
|---|---|
| PubChem CID | 10521411 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | tert-butyl-dimethyl-[3-[(S)-phenyl(prop-2-enoxy)methyl]penta-1,4-dien-3-yloxy]silane |
| SMILES | C=CCO[C@@H](c1ccccc1)C(C=C)(C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O2Si/c1-9-17-22-19(18-15-13-12-14-16-18)21(10-2,11-3)23-24(7,8)20(4,5)6/h9-16,19H,1-3,17H2,4-8H3/t19-/m0/s1 |
| InChIKey | CRFKLUNIYXRSLI-IBGZPJMESA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|