C10H19F3N2 — CID 105215697
[1-(4-ethylcyclohexyl)-2,2,2-trifluoroethyl]hydrazine (PubChem CID 105215697) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is [1-(4-ethylcyclohexyl)-2,2,2-trifluoroethyl]hydrazine.
| Compound Name | [1-(4-ethylcyclohexyl)-2,2,2-trifluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105215697 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | [1-(4-ethylcyclohexyl)-2,2,2-trifluoroethyl]hydrazine |
| SMILES | CCC1CCC(C(NN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N2/c1-2-7-3-5-8(6-4-7)9(15-14)10(11,12)13/h7-9,15H,2-6,14H2,1H3 |
| InChIKey | IJCIURVUTJXDCP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|