C10H17F3N2O — CID 105215866
[2,2,2-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)ethyl]hydrazine (PubChem CID 105215866) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)ethyl]hydrazine.
| Compound Name | [2,2,2-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105215866 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [2,2,2-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)ethyl]hydrazine |
| SMILES | NNC(C1CCOC2(CCC2)C1)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O/c11-10(12,13)8(15-14)7-2-5-16-9(6-7)3-1-4-9/h7-8,15H,1-6,14H2 |
| InChIKey | BJBSMWLQVGSLJV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|