C16H22N2 — CID 105217339
1-(1-phenylcyclobutyl)hex-5-ynylhydrazine (PubChem CID 105217339) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-(1-phenylcyclobutyl)hex-5-ynylhydrazine.
| Compound Name | 1-(1-phenylcyclobutyl)hex-5-ynylhydrazine |
|---|---|
| PubChem CID | 105217339 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-(1-phenylcyclobutyl)hex-5-ynylhydrazine |
| SMILES | C#CCCCC(NN)C1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C16H22N2/c1-2-3-5-11-15(18-17)16(12-8-13-16)14-9-6-4-7-10-14/h1,4,6-7,9-10,15,18H,3,5,8,11-13,17H2 |
| InChIKey | TZYAGEFEZWPTLR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|