C19H32N2 — CID 105217567
[4,4-dimethyl-1-(1-phenylcyclohexyl)pentyl]hydrazine (PubChem CID 105217567) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is [4,4-dimethyl-1-(1-phenylcyclohexyl)pentyl]hydrazine.
| Compound Name | [4,4-dimethyl-1-(1-phenylcyclohexyl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105217567 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | [4,4-dimethyl-1-(1-phenylcyclohexyl)pentyl]hydrazine |
| SMILES | CC(C)(C)CCC(NN)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H32N2/c1-18(2,3)15-12-17(21-20)19(13-8-5-9-14-19)16-10-6-4-7-11-16/h4,6-7,10-11,17,21H,5,8-9,12-15,20H2,1-3H3 |
| InChIKey | OGCUFHLEEBLDJO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|