C17H23N3S — CID 105217549
[1-(1-phenylcyclohexyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105217549) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is [1-(1-phenylcyclohexyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(1-phenylcyclohexyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105217549 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [1-(1-phenylcyclohexyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cncs1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C17H23N3S/c18-20-16(11-15-12-19-13-21-15)17(9-5-2-6-10-17)14-7-3-1-4-8-14/h1,3-4,7-8,12-13,16,20H,2,5-6,9-11,18H2 |
| InChIKey | IKVBZARXDNXOBL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|