C13H18BrN3O — CID 105221501
[2-(5-bromo-3-pyridinyl)-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine (PubChem CID 105221501) has the molecular formula C13H18BrN3O and a molecular weight of 312.21 g/mol. Its IUPAC name is [2-(5-bromo-3-pyridinyl)-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-3-pyridinyl)-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105221501 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [2-(5-bromo-3-pyridinyl)-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cncc(Br)c1)C1CC2CCC1O2 |
| InChI | InChI=1S/C13H18BrN3O/c14-9-3-8(6-16-7-9)4-12(17-15)11-5-10-1-2-13(11)18-10/h3,6-7,10-13,17H,1-2,4-5,15H2 |
| InChIKey | HENPSWMCYZZCFD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|