C9H18N2O2 — CID 105221731
[2-methoxy-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine (PubChem CID 105221731) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is [2-methoxy-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine.
| Compound Name | [2-methoxy-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105221731 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | [2-methoxy-1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]hydrazine |
| SMILES | COCC(NN)C1CC2CCC1O2 |
| InChI | InChI=1S/C9H18N2O2/c1-12-5-8(11-10)7-4-6-2-3-9(7)13-6/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | LLRGVFOEMWVVCK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|