C9H17N3O2 — CID 131123362
1-amino-3-[1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]urea (PubChem CID 131123362) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-amino-3-[1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]urea.
| Compound Name | 1-amino-3-[1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 131123362 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 1-amino-3-[1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)NN)C1CC2CCC1O2 |
| InChI | InChI=1S/C9H17N3O2/c1-5(11-9(13)12-10)7-4-6-2-3-8(7)14-6/h5-8H,2-4,10H2,1H3,(H2,11,12,13) |
| InChIKey | LPWDGMUOAVNFAW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|