C8H15NO3S — CID 130966059
1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethanesulfonamide (PubChem CID 130966059) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethanesulfonamide.
| Compound Name | 1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 130966059 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 1-(7-oxabicyclo[2.2.1]heptan-2-yl)ethanesulfonamide |
| SMILES | CC(C1CC2CCC1O2)S(N)(=O)=O |
| InChI | InChI=1S/C8H15NO3S/c1-5(13(9,10)11)7-4-6-2-3-8(7)12-6/h5-8H,2-4H2,1H3,(H2,9,10,11) |
| InChIKey | PXAVEFABONXUEI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |