C13H17N5 — CID 105223965
3-[(2-aminophenyl)-hydrazinylmethyl]-4-methylpyridin-2-amine (PubChem CID 105223965) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-[(2-aminophenyl)-hydrazinylmethyl]-4-methylpyridin-2-amine.
| Compound Name | 3-[(2-aminophenyl)-hydrazinylmethyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105223965 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-[(2-aminophenyl)-hydrazinylmethyl]-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N)c1C(NN)c1ccccc1N |
| InChI | InChI=1S/C13H17N5/c1-8-6-7-17-13(15)11(8)12(18-16)9-4-2-3-5-10(9)14/h2-7,12,18H,14,16H2,1H3,(H2,15,17) |
| InChIKey | VUWMFYVICBJYPI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|