C8H11ClF2N4 — CID 105265616
3-(2-chloro-2,2-difluoro-1-hydrazinylethyl)-4-methylpyridin-2-amine (PubChem CID 105265616) has the molecular formula C8H11ClF2N4 and a molecular weight of 236.65 g/mol. Its IUPAC name is 3-(2-chloro-2,2-difluoro-1-hydrazinylethyl)-4-methylpyridin-2-amine.
| Compound Name | 3-(2-chloro-2,2-difluoro-1-hydrazinylethyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105265616 |
| Molecular Formula | C8H11ClF2N4 |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(2-chloro-2,2-difluoro-1-hydrazinylethyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N)c1C(NN)C(F)(F)Cl |
| InChI | InChI=1S/C8H11ClF2N4/c1-4-2-3-14-7(12)5(4)6(15-13)8(9,10)11/h2-3,6,15H,13H2,1H3,(H2,12,14) |
| InChIKey | FQWIXRBXIWRHQD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|