C10H14F3N3 — CID 79954083
3-(1-amino-4,4,4-trifluorobutyl)-4-methylpyridin-2-amine (PubChem CID 79954083) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-(1-amino-4,4,4-trifluorobutyl)-4-methylpyridin-2-amine.
| Compound Name | 3-(1-amino-4,4,4-trifluorobutyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79954083 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-(1-amino-4,4,4-trifluorobutyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N)c1C(N)CCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3/c1-6-3-5-16-9(15)8(6)7(14)2-4-10(11,12)13/h3,5,7H,2,4,14H2,1H3,(H2,15,16) |
| InChIKey | DTKYERSKBPVWFO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |