C11H22N4OS — CID 105225373
[2-ethylsulfanyl-1-(4-methoxy-1-propylpyrazol-5-yl)ethyl]hydrazine (PubChem CID 105225373) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is [2-ethylsulfanyl-1-(4-methoxy-1-propylpyrazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-ethylsulfanyl-1-(4-methoxy-1-propylpyrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105225373 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [2-ethylsulfanyl-1-(4-methoxy-1-propylpyrazol-5-yl)ethyl]hydrazine |
| SMILES | CCCn1ncc(OC)c1C(CSCC)NN |
| InChI | InChI=1S/C11H22N4OS/c1-4-6-15-11(10(16-3)7-13-15)9(14-12)8-17-5-2/h7,9,14H,4-6,8,12H2,1-3H3 |
| InChIKey | NEQMINKUVPLQHJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|