C10H16N6OS — CID 105339799
[(4-methoxy-1-propylpyrazol-5-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine (PubChem CID 105339799) has the molecular formula C10H16N6OS and a molecular weight of 268.35 g/mol. Its IUPAC name is [(4-methoxy-1-propylpyrazol-5-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine.
| Compound Name | [(4-methoxy-1-propylpyrazol-5-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105339799 |
| Molecular Formula | C10H16N6OS |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [(4-methoxy-1-propylpyrazol-5-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine |
| SMILES | CCCn1ncc(OC)c1C(NN)c1cnsn1 |
| InChI | InChI=1S/C10H16N6OS/c1-3-4-16-10(8(17-2)6-12-16)9(14-11)7-5-13-18-15-7/h5-6,9,14H,3-4,11H2,1-2H3 |
| InChIKey | HIFUJSKFOCZWAK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|