C13H20N6O — CID 105260511
[(4-methoxy-1-propylpyrazol-5-yl)-(2-methylpyrimidin-4-yl)methyl]hydrazine (PubChem CID 105260511) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is [(4-methoxy-1-propylpyrazol-5-yl)-(2-methylpyrimidin-4-yl)methyl]hydrazine.
| Compound Name | [(4-methoxy-1-propylpyrazol-5-yl)-(2-methylpyrimidin-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105260511 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(4-methoxy-1-propylpyrazol-5-yl)-(2-methylpyrimidin-4-yl)methyl]hydrazine |
| SMILES | CCCn1ncc(OC)c1C(NN)c1ccnc(C)n1 |
| InChI | InChI=1S/C13H20N6O/c1-4-7-19-13(11(20-3)8-16-19)12(18-14)10-5-6-15-9(2)17-10/h5-6,8,12,18H,4,7,14H2,1-3H3 |
| InChIKey | GJYGPLIBNXZHEM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|