C15H22N4OS — CID 105339854
[(4-methoxy-1-propylpyrazol-5-yl)-(4-methylsulfanylphenyl)methyl]hydrazine (PubChem CID 105339854) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is [(4-methoxy-1-propylpyrazol-5-yl)-(4-methylsulfanylphenyl)methyl]hydrazine.
| Compound Name | [(4-methoxy-1-propylpyrazol-5-yl)-(4-methylsulfanylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105339854 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [(4-methoxy-1-propylpyrazol-5-yl)-(4-methylsulfanylphenyl)methyl]hydrazine |
| SMILES | CCCn1ncc(OC)c1C(NN)c1ccc(SC)cc1 |
| InChI | InChI=1S/C15H22N4OS/c1-4-9-19-15(13(20-2)10-17-19)14(18-16)11-5-7-12(21-3)8-6-11/h5-8,10,14,18H,4,9,16H2,1-3H3 |
| InChIKey | BYGFZMVKDIRCAB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|