C10H17N7O — CID 105254778
[(4-methoxy-1-propylpyrazol-5-yl)-(2H-triazol-4-yl)methyl]hydrazine (PubChem CID 105254778) has the molecular formula C10H17N7O and a molecular weight of 251.29 g/mol. Its IUPAC name is [(4-methoxy-1-propylpyrazol-5-yl)-(2H-triazol-4-yl)methyl]hydrazine.
| Compound Name | [(4-methoxy-1-propylpyrazol-5-yl)-(2H-triazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105254778 |
| Molecular Formula | C10H17N7O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [(4-methoxy-1-propylpyrazol-5-yl)-(2H-triazol-4-yl)methyl]hydrazine |
| SMILES | CCCn1ncc(OC)c1C(NN)c1cn[nH]n1 |
| InChI | InChI=1S/C10H17N7O/c1-3-4-17-10(8(18-2)6-13-17)9(14-11)7-5-12-16-15-7/h5-6,9,14H,3-4,11H2,1-2H3,(H,12,15,16) |
| InChIKey | GYLTWCSALUZJML-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|