C12H16Br2N4OS — CID 107970637
[(2,5-dibromothiophen-3-yl)-(4-methoxy-1-propylpyrazol-5-yl)methyl]hydrazine (PubChem CID 107970637) has the molecular formula C12H16Br2N4OS and a molecular weight of 424.16 g/mol. Its IUPAC name is [(2,5-dibromothiophen-3-yl)-(4-methoxy-1-propylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(2,5-dibromothiophen-3-yl)-(4-methoxy-1-propylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107970637 |
| Molecular Formula | C12H16Br2N4OS |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | [(2,5-dibromothiophen-3-yl)-(4-methoxy-1-propylpyrazol-5-yl)methyl]hydrazine |
| SMILES | CCCn1ncc(OC)c1C(NN)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H16Br2N4OS/c1-3-4-18-11(8(19-2)6-16-18)10(17-15)7-5-9(13)20-12(7)14/h5-6,10,17H,3-4,15H2,1-2H3 |
| InChIKey | QLFXPWUTZYQPRA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|