C15H24N2S — CID 105225635
[1-(2,3-dihydro-1H-inden-5-yl)-3-propylsulfanylpropan-2-yl]hydrazine (PubChem CID 105225635) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-5-yl)-3-propylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1H-inden-5-yl)-3-propylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105225635 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-5-yl)-3-propylsulfanylpropan-2-yl]hydrazine |
| SMILES | CCCSCC(Cc1ccc2c(c1)CCC2)NN |
| InChI | InChI=1S/C15H24N2S/c1-2-8-18-11-15(17-16)10-12-6-7-13-4-3-5-14(13)9-12/h6-7,9,15,17H,2-5,8,10-11,16H2,1H3 |
| InChIKey | CPOJDVOIBDDEAV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|