C12H19BrN2S — CID 105225748
[1-(3-bromophenyl)-3-propylsulfanylpropan-2-yl]hydrazine (PubChem CID 105225748) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is [1-(3-bromophenyl)-3-propylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(3-bromophenyl)-3-propylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105225748 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [1-(3-bromophenyl)-3-propylsulfanylpropan-2-yl]hydrazine |
| SMILES | CCCSCC(Cc1cccc(Br)c1)NN |
| InChI | InChI=1S/C12H19BrN2S/c1-2-6-16-9-12(15-14)8-10-4-3-5-11(13)7-10/h3-5,7,12,15H,2,6,8-9,14H2,1H3 |
| InChIKey | QBCYGMCJKIKAIB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|