C14H24N2S — CID 105225778
[1-(2,6-dimethylphenyl)-3-propylsulfanylpropan-2-yl]hydrazine (PubChem CID 105225778) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is [1-(2,6-dimethylphenyl)-3-propylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(2,6-dimethylphenyl)-3-propylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105225778 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [1-(2,6-dimethylphenyl)-3-propylsulfanylpropan-2-yl]hydrazine |
| SMILES | CCCSCC(Cc1c(C)cccc1C)NN |
| InChI | InChI=1S/C14H24N2S/c1-4-8-17-10-13(16-15)9-14-11(2)6-5-7-12(14)3/h5-7,13,16H,4,8-10,15H2,1-3H3 |
| InChIKey | KHLIKGWDYDVXMM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|