C15H14F4N2O4 — CID 10522635
(2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoic acid (PubChem CID 10522635) has the molecular formula C15H14F4N2O4 and a molecular weight of 362.28 g/mol. Its IUPAC name is (2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoic acid.
| Compound Name | (2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10522635 |
| Molecular Formula | C15H14F4N2O4 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (2R)-2-[2-oxo-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-1-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)n1ccn(-c2ccc(OCC(F)(F)C(F)F)cc2)c1=O |
| InChI | InChI=1S/C15H14F4N2O4/c1-9(12(22)23)20-6-7-21(14(20)24)10-2-4-11(5-3-10)25-8-15(18,19)13(16)17/h2-7,9,13H,8H2,1H3,(H,22,23)/t9-/m1/s1 |
| InChIKey | TZNNTWNMVCQSKO-SECBINFHSA-N |
| XLogP | 2.56 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|