C12H12F6N2O2 — CID 2836445
1-(4-ethoxyphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea (PubChem CID 2836445) has the molecular formula C12H12F6N2O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
|---|---|
| PubChem CID | 2836445 |
| Molecular Formula | C12H12F6N2O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
| SMILES | CCOc1ccc(NC(=O)NC(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F6N2O2/c1-2-22-8-5-3-7(4-6-8)19-10(21)20-9(11(13,14)15)12(16,17)18/h3-6,9H,2H2,1H3,(H2,19,20,21) |
| InChIKey | KJWMJYAYZFLGCZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |