C11H20N2S2 — CID 105226405
[2-tert-butylsulfanyl-1-(5-methylthiophen-2-yl)ethyl]hydrazine (PubChem CID 105226405) has the molecular formula C11H20N2S2 and a molecular weight of 244.43 g/mol. Its IUPAC name is [2-tert-butylsulfanyl-1-(5-methylthiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-tert-butylsulfanyl-1-(5-methylthiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105226405 |
| Molecular Formula | C11H20N2S2 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [2-tert-butylsulfanyl-1-(5-methylthiophen-2-yl)ethyl]hydrazine |
| SMILES | Cc1ccc(C(CSC(C)(C)C)NN)s1 |
| InChI | InChI=1S/C11H20N2S2/c1-8-5-6-10(15-8)9(13-12)7-14-11(2,3)4/h5-6,9,13H,7,12H2,1-4H3 |
| InChIKey | WIDAMFVYPBDVCO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|