C9H17N3S — CID 105244702
2-hydrazinyl-N,N-dimethyl-2-(5-methylthiophen-2-yl)ethanamine (PubChem CID 105244702) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-dimethyl-2-(5-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-hydrazinyl-N,N-dimethyl-2-(5-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 105244702 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-hydrazinyl-N,N-dimethyl-2-(5-methylthiophen-2-yl)ethanamine |
| SMILES | Cc1ccc(C(CN(C)C)NN)s1 |
| InChI | InChI=1S/C9H17N3S/c1-7-4-5-9(13-7)8(11-10)6-12(2)3/h4-5,8,11H,6,10H2,1-3H3 |
| InChIKey | ASCUHKWEVZPLHW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|