C12H28N2S — CID 105226501
(1-tert-butylsulfanyl-5,5-dimethylhexan-2-yl)hydrazine (PubChem CID 105226501) has the molecular formula C12H28N2S and a molecular weight of 232.44 g/mol. Its IUPAC name is (1-tert-butylsulfanyl-5,5-dimethylhexan-2-yl)hydrazine.
| Compound Name | (1-tert-butylsulfanyl-5,5-dimethylhexan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105226501 |
| Molecular Formula | C12H28N2S |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | (1-tert-butylsulfanyl-5,5-dimethylhexan-2-yl)hydrazine |
| SMILES | CC(C)(C)CCC(CSC(C)(C)C)NN |
| InChI | InChI=1S/C12H28N2S/c1-11(2,3)8-7-10(14-13)9-15-12(4,5)6/h10,14H,7-9,13H2,1-6H3 |
| InChIKey | DOTRQHPCNHZLRQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|