C18H26N2 — CID 105300017
(5,5-dimethyl-1-naphthalen-2-ylhexan-2-yl)hydrazine (PubChem CID 105300017) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (5,5-dimethyl-1-naphthalen-2-ylhexan-2-yl)hydrazine.
| Compound Name | (5,5-dimethyl-1-naphthalen-2-ylhexan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105300017 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (5,5-dimethyl-1-naphthalen-2-ylhexan-2-yl)hydrazine |
| SMILES | CC(C)(C)CCC(Cc1ccc2ccccc2c1)NN |
| InChI | InChI=1S/C18H26N2/c1-18(2,3)11-10-17(20-19)13-14-8-9-15-6-4-5-7-16(15)12-14/h4-9,12,17,20H,10-11,13,19H2,1-3H3 |
| InChIKey | ZBNCVFNJNCDINA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|