C13H26ClN5S — CID 105227166
2-[5-(2-butan-2-ylsulfanyl-1-hydrazinylethyl)-4-chloropyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105227166) has the molecular formula C13H26ClN5S and a molecular weight of 319.91 g/mol. Its IUPAC name is 2-[5-(2-butan-2-ylsulfanyl-1-hydrazinylethyl)-4-chloropyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[5-(2-butan-2-ylsulfanyl-1-hydrazinylethyl)-4-chloropyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105227166 |
| Molecular Formula | C13H26ClN5S |
| Molecular Weight | 319.91 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-[5-(2-butan-2-ylsulfanyl-1-hydrazinylethyl)-4-chloropyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CCC(C)SCC(NN)c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C13H26ClN5S/c1-5-10(2)20-9-12(17-15)13-11(14)8-16-19(13)7-6-18(3)4/h8,10,12,17H,5-7,9,15H2,1-4H3 |
| InChIKey | UAUJOGHWUROCEE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|